About 1-butoxyethyl (E)-4-butoxy-2-methylpent-2-enoate
1-butoxyethyl (E)-4-butoxy-2-methylpent-2-enoate (PubChem CID 142687000) has the molecular formula C16H30O4
and a molecular weight of 286.41 g/mol. Its IUPAC name is 1-butoxyethyl (E)-4-butoxy-2-methylpent-2-enoate.
Molecular Properties
| Compound Name | 1-butoxyethyl (E)-4-butoxy-2-methylpent-2-enoate |
| PubChem CID | 142687000 |
| Molecular Formula | C16H30O4 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | 1-butoxyethyl (E)-4-butoxy-2-methylpent-2-enoate |
| SMILES | CCCCOC(C)/C=C(\C)C(=O)OC(C)OCCCC |
| InChI | InChI=1S/C16H30O4/c1-6-8-10-18-14(4)12-13(3)16(17)20-15(5)19-11-9-7-2/h12,14-15H,6-11H2,1-5H3/b13-12+ |
| InChIKey | NDQXCYQWGMJMAJ-OUKQBFOZSA-N |
| XLogP | 3.84 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-butoxyethyl (E)-4-butoxy-2-methylpent-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butoxyethyl (E)-4-butoxy-2-methylpent-2-enoate?
The IUPAC name of 1-butoxyethyl (E)-4-butoxy-2-methylpent-2-enoate (CID 142687000) is 1-butoxyethyl (E)-4-butoxy-2-methylpent-2-enoate.
What is the SMILES notation for 1-butoxyethyl (E)-4-butoxy-2-methylpent-2-enoate?
The canonical SMILES for 1-butoxyethyl (E)-4-butoxy-2-methylpent-2-enoate is CCCCOC(C)/C=C(\C)C(=O)OC(C)OCCCC.
What is the InChIKey of 1-butoxyethyl (E)-4-butoxy-2-methylpent-2-enoate?
The InChIKey is NDQXCYQWGMJMAJ-OUKQBFOZSA-N. The full InChI is InChI=1S/C16H30O4/c1-6-8-10-18-14(4)12-13(3)16(17)20-15(5)19-11-9-7-2/h12,14-15H,6-11H2,1-5H3/b13-12+.
What are the key properties of 1-butoxyethyl (E)-4-butoxy-2-methylpent-2-enoate?
1-butoxyethyl (E)-4-butoxy-2-methylpent-2-enoate has a molecular weight of 286.41 g/mol, XLogP of 3.84, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butoxyethyl (E)-4-butoxy-2-methylpent-2-enoate is sourced from PubChem (CID 142687000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).