About 3-(1-butoxyethoxy)-2-methylprop-2-enoic acid;ethanol
3-(1-butoxyethoxy)-2-methylprop-2-enoic acid;ethanol (PubChem CID 173210897) has the molecular formula C24H60O11
and a molecular weight of 524.73 g/mol. Its IUPAC name is 3-(1-butoxyethoxy)-2-methylprop-2-enoic acid;ethanol.
Molecular Properties
| Compound Name | 3-(1-butoxyethoxy)-2-methylprop-2-enoic acid;ethanol |
| PubChem CID | 173210897 |
| Molecular Formula | C24H60O11 |
| Molecular Weight | 524.73 g/mol |
| Exact Mass | 524.41 |
| IUPAC Name | 3-(1-butoxyethoxy)-2-methylprop-2-enoic acid;ethanol |
| SMILES | CCCCOC(C)OC=C(C)C(=O)O.CCO.CCO.CCO.CCO.CCO.CCO.CCO |
| InChI | InChI=1S/C10H18O4.7C2H6O/c1-4-5-6-13-9(3)14-7-8(2)10(11)12;7*1-2-3/h7,9H,4-6H2,1-3H3,(H,11,12);7*3H,2H2,1H3 |
| InChIKey | SUWISHPTFURLBG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 197.37 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 524.73 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-butoxyethoxy)-2-methylprop-2-enoic acid;ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-butoxyethoxy)-2-methylprop-2-enoic acid;ethanol?
The IUPAC name of 3-(1-butoxyethoxy)-2-methylprop-2-enoic acid;ethanol (CID 173210897) is 3-(1-butoxyethoxy)-2-methylprop-2-enoic acid;ethanol.
What is the SMILES notation for 3-(1-butoxyethoxy)-2-methylprop-2-enoic acid;ethanol?
The canonical SMILES for 3-(1-butoxyethoxy)-2-methylprop-2-enoic acid;ethanol is CCCCOC(C)OC=C(C)C(=O)O.CCO.CCO.CCO.CCO.CCO.CCO.CCO.
What is the InChIKey of 3-(1-butoxyethoxy)-2-methylprop-2-enoic acid;ethanol?
The InChIKey is SUWISHPTFURLBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O4.7C2H6O/c1-4-5-6-13-9(3)14-7-8(2)10(11)12;7*1-2-3/h7,9H,4-6H2,1-3H3,(H,11,12);7*3H,2H2,1H3.
What are the key properties of 3-(1-butoxyethoxy)-2-methylprop-2-enoic acid;ethanol?
3-(1-butoxyethoxy)-2-methylprop-2-enoic acid;ethanol has a molecular weight of 524.73 g/mol, XLogP of 2.14, 7 rotatable bonds, 8 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-butoxyethoxy)-2-methylprop-2-enoic acid;ethanol is sourced from PubChem (CID 173210897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).