C47H92O3S3Sn — CID 139676871
O-[bis(2,10-dimethylundecanethioyloxy)-octylstannyl] 2,10-dimethylundecanethioate (PubChem CID 139676871) has the molecular formula C47H92O3S3Sn and a molecular weight of 920.16 g/mol. Its IUPAC name is O-[bis(2,10-dimethylundecanethioyloxy)-octylstannyl] 2,10-dimethylundecanethioate.
| Compound Name | O-[bis(2,10-dimethylundecanethioyloxy)-octylstannyl] 2,10-dimethylundecanethioate |
|---|---|
| PubChem CID | 139676871 |
| Molecular Formula | C47H92O3S3Sn |
| Molecular Weight | 920.16 g/mol |
| Exact Mass | 920.52 |
| IUPAC Name | O-[bis(2,10-dimethylundecanethioyloxy)-octylstannyl] 2,10-dimethylundecanethioate |
| SMILES | CCCCCCCC[Sn](OC(=S)C(C)CCCCCCCC(C)C)(OC(=S)C(C)CCCCCCCC(C)C)OC(=S)C(C)CCCCCCCC(C)C |
| InChI | InChI=1S/3C13H26OS.C8H17.Sn/c3*1-11(2)9-7-5-4-6-8-10-12(3)13(14)15;1-3-5-7-8-6-4-2;/h3*11-12H,4-10H2,1-3H3,(H,14,15);1,3-8H2,2H3;/q;;;;+3/p-3 |
| InChIKey | CZKSWIPBFNNKDG-UHFFFAOYSA-K |
| XLogP | 17.39 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 920.16 |
| LogP ≤ 5 | 17.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|