C12H10I2 — CID 139917317
1,4-bis(iodomethyl)naphthalene (PubChem CID 139917317) has the molecular formula C12H10I2 and a molecular weight of 408.02 g/mol. Its IUPAC name is 1,4-bis(iodomethyl)naphthalene.
| Compound Name | 1,4-bis(iodomethyl)naphthalene |
|---|---|
| PubChem CID | 139917317 |
| Molecular Formula | C12H10I2 |
| Molecular Weight | 408.02 g/mol |
| Exact Mass | 407.89 |
| IUPAC Name | 1,4-bis(iodomethyl)naphthalene |
| SMILES | ICc1ccc(CI)c2ccccc12 |
| InChI | InChI=1S/C12H10I2/c13-7-9-5-6-10(8-14)12-4-2-1-3-11(9)12/h1-6H,7-8H2 |
| InChIKey | DDQQUAIWPWSSGN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.02 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|