C16H16I4 — CID 67650229
1,2-bis(iodomethyl)benzene;1,3-bis(iodomethyl)benzene (PubChem CID 67650229) has the molecular formula C16H16I4 and a molecular weight of 715.92 g/mol. Its IUPAC name is 1,2-bis(iodomethyl)benzene;1,3-bis(iodomethyl)benzene.
| Compound Name | 1,2-bis(iodomethyl)benzene;1,3-bis(iodomethyl)benzene |
|---|---|
| PubChem CID | 67650229 |
| Molecular Formula | C16H16I4 |
| Molecular Weight | 715.92 g/mol |
| Exact Mass | 715.74 |
| IUPAC Name | 1,2-bis(iodomethyl)benzene;1,3-bis(iodomethyl)benzene |
| SMILES | ICc1cccc(CI)c1.ICc1ccccc1CI |
| InChI | InChI=1S/2C8H8I2/c9-5-7-2-1-3-8(4-7)6-10;9-5-7-3-1-2-4-8(7)6-10/h2*1-4H,5-6H2 |
| InChIKey | LVCYVALGYHFHKS-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.92 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|