C9H10I2 — CID 67628819
1,3-bis(iodomethyl)-2-methylbenzene (PubChem CID 67628819) has the molecular formula C9H10I2 and a molecular weight of 371.99 g/mol. Its IUPAC name is 1,3-bis(iodomethyl)-2-methylbenzene.
| Compound Name | 1,3-bis(iodomethyl)-2-methylbenzene |
|---|---|
| PubChem CID | 67628819 |
| Molecular Formula | C9H10I2 |
| Molecular Weight | 371.99 g/mol |
| Exact Mass | 371.89 |
| IUPAC Name | 1,3-bis(iodomethyl)-2-methylbenzene |
| SMILES | Cc1c(CI)cccc1CI |
| InChI | InChI=1S/C9H10I2/c1-7-8(5-10)3-2-4-9(7)6-11/h2-4H,5-6H2,1H3 |
| InChIKey | UIUVXHXUJNCLGU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.99 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|