C24H29NO6 — CID 139919798
[3-(2,6-dimethylphenyl)-1-(ethoxymethoxy)-2,8-dioxo-1-azaspiro[4.5]dec-3-en-4-yl] cyclopropanecarboxylate (PubChem CID 139919798) has the molecular formula C24H29NO6 and a molecular weight of 427.50 g/mol. Its IUPAC name is [3-(2,6-dimethylphenyl)-1-(ethoxymethoxy)-2,8-dioxo-1-azaspiro[4.5]dec-3-en-4-yl] cyclopropanecarboxylate.
| Compound Name | [3-(2,6-dimethylphenyl)-1-(ethoxymethoxy)-2,8-dioxo-1-azaspiro[4.5]dec-3-en-4-yl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 139919798 |
| Molecular Formula | C24H29NO6 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | [3-(2,6-dimethylphenyl)-1-(ethoxymethoxy)-2,8-dioxo-1-azaspiro[4.5]dec-3-en-4-yl] cyclopropanecarboxylate |
| SMILES | CCOCON1C(=O)C(c2c(C)cccc2C)=C(OC(=O)C2CC2)C12CCC(=O)CC2 |
| InChI | InChI=1S/C24H29NO6/c1-4-29-14-30-25-22(27)20(19-15(2)6-5-7-16(19)3)21(31-23(28)17-8-9-17)24(25)12-10-18(26)11-13-24/h5-7,17H,4,8-14H2,1-3H3 |
| InChIKey | WSVFGYBWRIYZRI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|