C23H33NO6 — CID 139860097
3-(2,6-dimethylphenyl)-1,8-bis(ethoxymethoxy)-4-hydroxy-1-azaspiro[4.5]dec-3-en-2-one (PubChem CID 139860097) has the molecular formula C23H33NO6 and a molecular weight of 419.52 g/mol. Its IUPAC name is 3-(2,6-dimethylphenyl)-1,8-bis(ethoxymethoxy)-4-hydroxy-1-azaspiro[4.5]dec-3-en-2-one.
| Compound Name | 3-(2,6-dimethylphenyl)-1,8-bis(ethoxymethoxy)-4-hydroxy-1-azaspiro[4.5]dec-3-en-2-one |
|---|---|
| PubChem CID | 139860097 |
| Molecular Formula | C23H33NO6 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | 3-(2,6-dimethylphenyl)-1,8-bis(ethoxymethoxy)-4-hydroxy-1-azaspiro[4.5]dec-3-en-2-one |
| SMILES | CCOCOC1CCC2(CC1)C(O)=C(c1c(C)cccc1C)C(=O)N2OCOCC |
| InChI | InChI=1S/C23H33NO6/c1-5-27-14-29-18-10-12-23(13-11-18)21(25)20(19-16(3)8-7-9-17(19)4)22(26)24(23)30-15-28-6-2/h7-9,18,25H,5-6,10-15H2,1-4H3 |
| InChIKey | WPANGCXYOBUZPK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|