C23H31NO5 — CID 139859661
[1-(ethoxymethoxy)-2,2-dimethyl-5-oxo-4-(2,4,6-trimethylphenyl)pyrrol-3-yl] cyclobutanecarboxylate (PubChem CID 139859661) has the molecular formula C23H31NO5 and a molecular weight of 401.50 g/mol. Its IUPAC name is [1-(ethoxymethoxy)-2,2-dimethyl-5-oxo-4-(2,4,6-trimethylphenyl)pyrrol-3-yl] cyclobutanecarboxylate.
| Compound Name | [1-(ethoxymethoxy)-2,2-dimethyl-5-oxo-4-(2,4,6-trimethylphenyl)pyrrol-3-yl] cyclobutanecarboxylate |
|---|---|
| PubChem CID | 139859661 |
| Molecular Formula | C23H31NO5 |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | [1-(ethoxymethoxy)-2,2-dimethyl-5-oxo-4-(2,4,6-trimethylphenyl)pyrrol-3-yl] cyclobutanecarboxylate |
| SMILES | CCOCON1C(=O)C(c2c(C)cc(C)cc2C)=C(OC(=O)C2CCC2)C1(C)C |
| InChI | InChI=1S/C23H31NO5/c1-7-27-13-28-24-21(25)19(18-15(3)11-14(2)12-16(18)4)20(23(24,5)6)29-22(26)17-9-8-10-17/h11-12,17H,7-10,13H2,1-6H3 |
| InChIKey | MSGJBUOGIQLCNQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|