C30H35Cl2NO6 — CID 139860136
[1-(ethoxymethoxy)-2,2-dimethyl-5-oxo-4-(2,4,6-trimethylphenyl)pyrrol-3-yl] 2,2-dichloro-1-(4-ethoxyphenyl)cyclopropane-1-carboxylate (PubChem CID 139860136) has the molecular formula C30H35Cl2NO6 and a molecular weight of 576.52 g/mol. Its IUPAC name is [1-(ethoxymethoxy)-2,2-dimethyl-5-oxo-4-(2,4,6-trimethylphenyl)pyrrol-3-yl] 2,2-dichloro-1-(4-ethoxyphenyl)cyclopropane-1-carboxylate.
| Compound Name | [1-(ethoxymethoxy)-2,2-dimethyl-5-oxo-4-(2,4,6-trimethylphenyl)pyrrol-3-yl] 2,2-dichloro-1-(4-ethoxyphenyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 139860136 |
| Molecular Formula | C30H35Cl2NO6 |
| Molecular Weight | 576.52 g/mol |
| Exact Mass | 575.18 |
| IUPAC Name | [1-(ethoxymethoxy)-2,2-dimethyl-5-oxo-4-(2,4,6-trimethylphenyl)pyrrol-3-yl] 2,2-dichloro-1-(4-ethoxyphenyl)cyclopropane-1-carboxylate |
| SMILES | CCOCON1C(=O)C(c2c(C)cc(C)cc2C)=C(OC(=O)C2(c3ccc(OCC)cc3)CC2(Cl)Cl)C1(C)C |
| InChI | InChI=1S/C30H35Cl2NO6/c1-8-36-17-38-33-26(34)24(23-19(4)14-18(3)15-20(23)5)25(28(33,6)7)39-27(35)29(16-30(29,31)32)21-10-12-22(13-11-21)37-9-2/h10-15H,8-9,16-17H2,1-7H3 |
| InChIKey | BTJHSPOOKLBFPP-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.52 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|