C26H20Cl2FNO4 — CID 54148851
[cyano-(4-fluoro-3-phenoxyphenyl)methyl] 2,2-dichloro-1-(4-ethoxyphenyl)cyclopropane-1-carboxylate (PubChem CID 54148851) has the molecular formula C26H20Cl2FNO4 and a molecular weight of 500.35 g/mol. Its IUPAC name is [cyano-(4-fluoro-3-phenoxyphenyl)methyl] 2,2-dichloro-1-(4-ethoxyphenyl)cyclopropane-1-carboxylate.
| Compound Name | [cyano-(4-fluoro-3-phenoxyphenyl)methyl] 2,2-dichloro-1-(4-ethoxyphenyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 54148851 |
| Molecular Formula | C26H20Cl2FNO4 |
| Molecular Weight | 500.35 g/mol |
| Exact Mass | 499.08 |
| IUPAC Name | [cyano-(4-fluoro-3-phenoxyphenyl)methyl] 2,2-dichloro-1-(4-ethoxyphenyl)cyclopropane-1-carboxylate |
| SMILES | CCOc1ccc(C2(C(=O)OC(C#N)c3ccc(F)c(Oc4ccccc4)c3)CC2(Cl)Cl)cc1 |
| InChI | InChI=1S/C26H20Cl2FNO4/c1-2-32-19-11-9-18(10-12-19)25(16-26(25,27)28)24(31)34-23(15-30)17-8-13-21(29)22(14-17)33-20-6-4-3-5-7-20/h3-14,23H,2,16H2,1H3 |
| InChIKey | OGHVJTBIFVCMKP-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.35 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|