C28H26ClNO4 — CID 149348364
[cyano-(3-phenoxyphenyl)methyl] 2-chloro-1-(4-ethoxy-2-methylphenyl)-2-methylcyclopropane-1-carboxylate (PubChem CID 149348364) has the molecular formula C28H26ClNO4 and a molecular weight of 475.97 g/mol. Its IUPAC name is [cyano-(3-phenoxyphenyl)methyl] 2-chloro-1-(4-ethoxy-2-methylphenyl)-2-methylcyclopropane-1-carboxylate.
| Compound Name | [cyano-(3-phenoxyphenyl)methyl] 2-chloro-1-(4-ethoxy-2-methylphenyl)-2-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 149348364 |
| Molecular Formula | C28H26ClNO4 |
| Molecular Weight | 475.97 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | [cyano-(3-phenoxyphenyl)methyl] 2-chloro-1-(4-ethoxy-2-methylphenyl)-2-methylcyclopropane-1-carboxylate |
| SMILES | CCOc1ccc(C2(C(=O)OC(C#N)c3cccc(Oc4ccccc4)c3)CC2(C)Cl)c(C)c1 |
| InChI | InChI=1S/C28H26ClNO4/c1-4-32-22-13-14-24(19(2)15-22)28(18-27(28,3)29)26(31)34-25(17-30)20-9-8-12-23(16-20)33-21-10-6-5-7-11-21/h5-16,25H,4,18H2,1-3H3 |
| InChIKey | YFNBOKNPGUKFCI-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.97 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|