C28H19Cl2NO3 — CID 70561364
[cyano-(3-phenoxyphenyl)methyl] 2,2-dichloro-1-naphthalen-2-ylcyclopropane-1-carboxylate (PubChem CID 70561364) has the molecular formula C28H19Cl2NO3 and a molecular weight of 488.37 g/mol. Its IUPAC name is [cyano-(3-phenoxyphenyl)methyl] 2,2-dichloro-1-naphthalen-2-ylcyclopropane-1-carboxylate.
| Compound Name | [cyano-(3-phenoxyphenyl)methyl] 2,2-dichloro-1-naphthalen-2-ylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 70561364 |
| Molecular Formula | C28H19Cl2NO3 |
| Molecular Weight | 488.37 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | [cyano-(3-phenoxyphenyl)methyl] 2,2-dichloro-1-naphthalen-2-ylcyclopropane-1-carboxylate |
| SMILES | N#CC(OC(=O)C1(c2ccc3ccccc3c2)CC1(Cl)Cl)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C28H19Cl2NO3/c29-28(30)18-27(28,22-14-13-19-7-4-5-8-20(19)15-22)26(32)34-25(17-31)21-9-6-12-24(16-21)33-23-10-2-1-3-11-23/h1-16,25H,18H2 |
| InChIKey | AFZUJMLMSCJYEZ-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.37 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|