C21H28ClNO4 — CID 139859978
[1-(chloromethoxy)-2,2-dimethyl-5-oxo-4-(2,4,6-trimethylphenyl)pyrrol-3-yl] 2,2-dimethylpropanoate (PubChem CID 139859978) has the molecular formula C21H28ClNO4 and a molecular weight of 393.91 g/mol. Its IUPAC name is [1-(chloromethoxy)-2,2-dimethyl-5-oxo-4-(2,4,6-trimethylphenyl)pyrrol-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [1-(chloromethoxy)-2,2-dimethyl-5-oxo-4-(2,4,6-trimethylphenyl)pyrrol-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 139859978 |
| Molecular Formula | C21H28ClNO4 |
| Molecular Weight | 393.91 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | [1-(chloromethoxy)-2,2-dimethyl-5-oxo-4-(2,4,6-trimethylphenyl)pyrrol-3-yl] 2,2-dimethylpropanoate |
| SMILES | Cc1cc(C)c(C2=C(OC(=O)C(C)(C)C)C(C)(C)N(OCCl)C2=O)c(C)c1 |
| InChI | InChI=1S/C21H28ClNO4/c1-12-9-13(2)15(14(3)10-12)16-17(27-19(25)20(4,5)6)21(7,8)23(18(16)24)26-11-22/h9-10H,11H2,1-8H3 |
| InChIKey | ANQGPNMGZNUOOW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.91 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|