C22H31NO5 — CID 139859810
[1-(methoxymethoxy)-2,2-dimethyl-5-oxo-4-(2,4,6-trimethylphenyl)pyrrol-3-yl] 2,2-dimethylpropanoate (PubChem CID 139859810) has the molecular formula C22H31NO5 and a molecular weight of 389.49 g/mol. Its IUPAC name is [1-(methoxymethoxy)-2,2-dimethyl-5-oxo-4-(2,4,6-trimethylphenyl)pyrrol-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [1-(methoxymethoxy)-2,2-dimethyl-5-oxo-4-(2,4,6-trimethylphenyl)pyrrol-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 139859810 |
| Molecular Formula | C22H31NO5 |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | [1-(methoxymethoxy)-2,2-dimethyl-5-oxo-4-(2,4,6-trimethylphenyl)pyrrol-3-yl] 2,2-dimethylpropanoate |
| SMILES | COCON1C(=O)C(c2c(C)cc(C)cc2C)=C(OC(=O)C(C)(C)C)C1(C)C |
| InChI | InChI=1S/C22H31NO5/c1-13-10-14(2)16(15(3)11-13)17-18(28-20(25)21(4,5)6)22(7,8)23(19(17)24)27-12-26-9/h10-11H,12H2,1-9H3 |
| InChIKey | DPVAZRICLMFRFZ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|