C24H27NO5 — CID 139859713
[4-(2,6-dimethylphenyl)-1-(methoxymethoxy)-2,2-dimethyl-5-oxopyrrol-3-yl] 2-methylbenzoate (PubChem CID 139859713) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is [4-(2,6-dimethylphenyl)-1-(methoxymethoxy)-2,2-dimethyl-5-oxopyrrol-3-yl] 2-methylbenzoate.
| Compound Name | [4-(2,6-dimethylphenyl)-1-(methoxymethoxy)-2,2-dimethyl-5-oxopyrrol-3-yl] 2-methylbenzoate |
|---|---|
| PubChem CID | 139859713 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | [4-(2,6-dimethylphenyl)-1-(methoxymethoxy)-2,2-dimethyl-5-oxopyrrol-3-yl] 2-methylbenzoate |
| SMILES | COCON1C(=O)C(c2c(C)cccc2C)=C(OC(=O)c2ccccc2C)C1(C)C |
| InChI | InChI=1S/C24H27NO5/c1-15-10-7-8-13-18(15)23(27)30-21-20(19-16(2)11-9-12-17(19)3)22(26)25(24(21,4)5)29-14-28-6/h7-13H,14H2,1-6H3 |
| InChIKey | WOTVMZFSTAFHDY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|