C23H23Cl2NO5 — CID 139859676
[4-(2,4-dichlorophenyl)-1-(ethoxymethoxy)-2,2-dimethyl-5-oxopyrrol-3-yl] 2-methylbenzoate (PubChem CID 139859676) has the molecular formula C23H23Cl2NO5 and a molecular weight of 464.35 g/mol. Its IUPAC name is [4-(2,4-dichlorophenyl)-1-(ethoxymethoxy)-2,2-dimethyl-5-oxopyrrol-3-yl] 2-methylbenzoate.
| Compound Name | [4-(2,4-dichlorophenyl)-1-(ethoxymethoxy)-2,2-dimethyl-5-oxopyrrol-3-yl] 2-methylbenzoate |
|---|---|
| PubChem CID | 139859676 |
| Molecular Formula | C23H23Cl2NO5 |
| Molecular Weight | 464.35 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | [4-(2,4-dichlorophenyl)-1-(ethoxymethoxy)-2,2-dimethyl-5-oxopyrrol-3-yl] 2-methylbenzoate |
| SMILES | CCOCON1C(=O)C(c2ccc(Cl)cc2Cl)=C(OC(=O)c2ccccc2C)C1(C)C |
| InChI | InChI=1S/C23H23Cl2NO5/c1-5-29-13-30-26-21(27)19(17-11-10-15(24)12-18(17)25)20(23(26,3)4)31-22(28)16-9-7-6-8-14(16)2/h6-12H,5,13H2,1-4H3 |
| InChIKey | QMEZQAQATWJQRF-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.35 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|