C24H25Cl2NO7 — CID 139860006
[4-(2,4-dichlorophenyl)-1-(ethoxymethoxy)-2,2-dimethyl-5-oxopyrrol-3-yl] 2,6-dimethoxybenzoate (PubChem CID 139860006) has the molecular formula C24H25Cl2NO7 and a molecular weight of 510.37 g/mol. Its IUPAC name is [4-(2,4-dichlorophenyl)-1-(ethoxymethoxy)-2,2-dimethyl-5-oxopyrrol-3-yl] 2,6-dimethoxybenzoate.
| Compound Name | [4-(2,4-dichlorophenyl)-1-(ethoxymethoxy)-2,2-dimethyl-5-oxopyrrol-3-yl] 2,6-dimethoxybenzoate |
|---|---|
| PubChem CID | 139860006 |
| Molecular Formula | C24H25Cl2NO7 |
| Molecular Weight | 510.37 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | [4-(2,4-dichlorophenyl)-1-(ethoxymethoxy)-2,2-dimethyl-5-oxopyrrol-3-yl] 2,6-dimethoxybenzoate |
| SMILES | CCOCON1C(=O)C(c2ccc(Cl)cc2Cl)=C(OC(=O)c2c(OC)cccc2OC)C1(C)C |
| InChI | InChI=1S/C24H25Cl2NO7/c1-6-32-13-33-27-22(28)19(15-11-10-14(25)12-16(15)26)21(24(27,2)3)34-23(29)20-17(30-4)8-7-9-18(20)31-5/h7-12H,6,13H2,1-5H3 |
| InChIKey | VTJZYQINOSTFNK-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.37 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|