C20H20Cl2N2O5 — CID 139859744
[4-(2,4-dichlorophenyl)-1-(ethoxymethoxy)-2,2-dimethyl-5-oxopyrrol-3-yl] 1-cyanocyclopropane-1-carboxylate (PubChem CID 139859744) has the molecular formula C20H20Cl2N2O5 and a molecular weight of 439.30 g/mol. Its IUPAC name is [4-(2,4-dichlorophenyl)-1-(ethoxymethoxy)-2,2-dimethyl-5-oxopyrrol-3-yl] 1-cyanocyclopropane-1-carboxylate.
| Compound Name | [4-(2,4-dichlorophenyl)-1-(ethoxymethoxy)-2,2-dimethyl-5-oxopyrrol-3-yl] 1-cyanocyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 139859744 |
| Molecular Formula | C20H20Cl2N2O5 |
| Molecular Weight | 439.30 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | [4-(2,4-dichlorophenyl)-1-(ethoxymethoxy)-2,2-dimethyl-5-oxopyrrol-3-yl] 1-cyanocyclopropane-1-carboxylate |
| SMILES | CCOCON1C(=O)C(c2ccc(Cl)cc2Cl)=C(OC(=O)C2(C#N)CC2)C1(C)C |
| InChI | InChI=1S/C20H20Cl2N2O5/c1-4-27-11-28-24-17(25)15(13-6-5-12(21)9-14(13)22)16(19(24,2)3)29-18(26)20(10-23)7-8-20/h5-6,9H,4,7-8,11H2,1-3H3 |
| InChIKey | BRLJDJPNCZWRIG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 88.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.30 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|