About 1-butylsulfanylbutyl bis(1-sulfanylbutyl) borate
1-butylsulfanylbutyl bis(1-sulfanylbutyl) borate (PubChem CID 139922364) has the molecular formula C16H35BO3S3
and a molecular weight of 382.47 g/mol. Its IUPAC name is 1-butylsulfanylbutyl bis(1-sulfanylbutyl) borate.
Molecular Properties
| Compound Name | 1-butylsulfanylbutyl bis(1-sulfanylbutyl) borate |
| PubChem CID | 139922364 |
| Molecular Formula | C16H35BO3S3 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 1-butylsulfanylbutyl bis(1-sulfanylbutyl) borate |
| SMILES | CCCCSC(CCC)OB(OC(S)CCC)OC(S)CCC |
| InChI | InChI=1S/C16H35BO3S3/c1-5-9-13-23-16(12-8-4)20-17(18-14(21)10-6-2)19-15(22)11-7-3/h14-16,21-22H,5-13H2,1-4H3 |
| InChIKey | GOXGEIXAWKGUKR-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-butylsulfanylbutyl bis(1-sulfanylbutyl) borate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butylsulfanylbutyl bis(1-sulfanylbutyl) borate?
The IUPAC name of 1-butylsulfanylbutyl bis(1-sulfanylbutyl) borate (CID 139922364) is 1-butylsulfanylbutyl bis(1-sulfanylbutyl) borate.
What is the SMILES notation for 1-butylsulfanylbutyl bis(1-sulfanylbutyl) borate?
The canonical SMILES for 1-butylsulfanylbutyl bis(1-sulfanylbutyl) borate is CCCCSC(CCC)OB(OC(S)CCC)OC(S)CCC.
What is the InChIKey of 1-butylsulfanylbutyl bis(1-sulfanylbutyl) borate?
The InChIKey is GOXGEIXAWKGUKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H35BO3S3/c1-5-9-13-23-16(12-8-4)20-17(18-14(21)10-6-2)19-15(22)11-7-3/h14-16,21-22H,5-13H2,1-4H3.
What are the key properties of 1-butylsulfanylbutyl bis(1-sulfanylbutyl) borate?
1-butylsulfanylbutyl bis(1-sulfanylbutyl) borate has a molecular weight of 382.47 g/mol, XLogP of 5.79, 16 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butylsulfanylbutyl bis(1-sulfanylbutyl) borate is sourced from PubChem (CID 139922364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).