About tris[(4-hexylphenyl)-bis(4-methylphenyl)-λ4-sulfanyl] stiborate
tris[(4-hexylphenyl)-bis(4-methylphenyl)-λ4-sulfanyl] stiborate (PubChem CID 139924171) has the molecular formula C78H93O4S3Sb
and a molecular weight of 1312.56 g/mol. Its IUPAC name is tris[(4-hexylphenyl)-bis(4-methylphenyl)-λ4-sulfanyl] stiborate.
Molecular Properties
| Compound Name | tris[(4-hexylphenyl)-bis(4-methylphenyl)-λ4-sulfanyl] stiborate |
| PubChem CID | 139924171 |
| Molecular Formula | C78H93O4S3Sb |
| Molecular Weight | 1312.56 g/mol |
| Exact Mass | 1310.53 |
| IUPAC Name | tris[(4-hexylphenyl)-bis(4-methylphenyl)-λ4-sulfanyl] stiborate |
| SMILES | CCCCCCc1ccc(S(O[Sb](=O)(OS(c2ccc(C)cc2)(c2ccc(C)cc2)c2ccc(CCCCCC)cc2)OS(c2ccc(C)cc2)(c2ccc(C)cc2)c2ccc(CCCCCC)cc2)(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/3C26H32OS.O.Sb/c3*1-4-5-6-7-8-23-13-19-26(20-14-23)28(27,24-15-9-21(2)10-16-24)25-17-11-22(3)12-18-25;;/h3*9-20,27H,4-8H2,1-3H3;;/q;;;;+3/p-3 |
| InChIKey | SKDVCJKVLQWBFF-UHFFFAOYSA-K |
| XLogP | 23.81 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 86 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1312.56 |
| LogP ≤ 5 | 23.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tris[(4-hexylphenyl)-bis(4-methylphenyl)-λ4-sulfanyl] stiborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris[(4-hexylphenyl)-bis(4-methylphenyl)-λ4-sulfanyl] stiborate?
The IUPAC name of tris[(4-hexylphenyl)-bis(4-methylphenyl)-λ4-sulfanyl] stiborate (CID 139924171) is tris[(4-hexylphenyl)-bis(4-methylphenyl)-λ4-sulfanyl] stiborate.
What is the SMILES notation for tris[(4-hexylphenyl)-bis(4-methylphenyl)-λ4-sulfanyl] stiborate?
The canonical SMILES for tris[(4-hexylphenyl)-bis(4-methylphenyl)-λ4-sulfanyl] stiborate is CCCCCCc1ccc(S(O[Sb](=O)(OS(c2ccc(C)cc2)(c2ccc(C)cc2)c2ccc(CCCCCC)cc2)OS(c2ccc(C)cc2)(c2ccc(C)cc2)c2ccc(CCCCCC)cc2)(c2ccc(C)cc2)c2ccc(C)cc2)cc1.
What is the InChIKey of tris[(4-hexylphenyl)-bis(4-methylphenyl)-λ4-sulfanyl] stiborate?
The InChIKey is SKDVCJKVLQWBFF-UHFFFAOYSA-K. The full InChI is InChI=1S/3C26H32OS.O.Sb/c3*1-4-5-6-7-8-23-13-19-26(20-14-23)28(27,24-15-9-21(2)10-16-24)25-17-11-22(3)12-18-25;;/h3*9-20,27H,4-8H2,1-3H3;;/q;;;;+3/p-3.
What are the key properties of tris[(4-hexylphenyl)-bis(4-methylphenyl)-λ4-sulfanyl] stiborate?
tris[(4-hexylphenyl)-bis(4-methylphenyl)-λ4-sulfanyl] stiborate has a molecular weight of 1312.56 g/mol, XLogP of 23.81, 30 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tris[(4-hexylphenyl)-bis(4-methylphenyl)-λ4-sulfanyl] stiborate is sourced from PubChem (CID 139924171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).