C11H7FO — CID 139924232
4-(5-fluoropenta-1,3-diynyl)phenol (PubChem CID 139924232) has the molecular formula C11H7FO and a molecular weight of 174.17 g/mol. Its IUPAC name is 4-(5-fluoropenta-1,3-diynyl)phenol.
| Compound Name | 4-(5-fluoropenta-1,3-diynyl)phenol |
|---|---|
| PubChem CID | 139924232 |
| Molecular Formula | C11H7FO |
| Molecular Weight | 174.17 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | 4-(5-fluoropenta-1,3-diynyl)phenol |
| SMILES | Oc1ccc(C#CC#CCF)cc1 |
| InChI | InChI=1S/C11H7FO/c12-9-3-1-2-4-10-5-7-11(13)8-6-10/h5-8,13H,9H2 |
| InChIKey | OTDAGPXKCMLNBO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.17 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|