C33H20O4 — CID 157453096
4-[5-(4-hydroxyphenyl)-3,3-bis[2-(4-hydroxyphenyl)ethynyl]penta-1,4-diynyl]phenol (PubChem CID 157453096) has the molecular formula C33H20O4 and a molecular weight of 480.52 g/mol. Its IUPAC name is 4-[5-(4-hydroxyphenyl)-3,3-bis[2-(4-hydroxyphenyl)ethynyl]penta-1,4-diynyl]phenol.
| Compound Name | 4-[5-(4-hydroxyphenyl)-3,3-bis[2-(4-hydroxyphenyl)ethynyl]penta-1,4-diynyl]phenol |
|---|---|
| PubChem CID | 157453096 |
| Molecular Formula | C33H20O4 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 4-[5-(4-hydroxyphenyl)-3,3-bis[2-(4-hydroxyphenyl)ethynyl]penta-1,4-diynyl]phenol |
| SMILES | Oc1ccc(C#CC(C#Cc2ccc(O)cc2)(C#Cc2ccc(O)cc2)C#Cc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C33H20O4/c34-29-9-1-25(2-10-29)17-21-33(22-18-26-3-11-30(35)12-4-26,23-19-27-5-13-31(36)14-6-27)24-20-28-7-15-32(37)16-8-28/h1-16,34-37H |
| InChIKey | BTAIDWYIVNDRIY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|