C15H7BrF4O — CID 145389413
4-[2-[4-[bromo(difluoro)methyl]-3,5-difluorophenyl]ethynyl]phenol (PubChem CID 145389413) has the molecular formula C15H7BrF4O and a molecular weight of 359.12 g/mol. Its IUPAC name is 4-[2-[4-[bromo(difluoro)methyl]-3,5-difluorophenyl]ethynyl]phenol.
| Compound Name | 4-[2-[4-[bromo(difluoro)methyl]-3,5-difluorophenyl]ethynyl]phenol |
|---|---|
| PubChem CID | 145389413 |
| Molecular Formula | C15H7BrF4O |
| Molecular Weight | 359.12 g/mol |
| Exact Mass | 357.96 |
| IUPAC Name | 4-[2-[4-[bromo(difluoro)methyl]-3,5-difluorophenyl]ethynyl]phenol |
| SMILES | Oc1ccc(C#Cc2cc(F)c(C(F)(F)Br)c(F)c2)cc1 |
| InChI | InChI=1S/C15H7BrF4O/c16-15(19,20)14-12(17)7-10(8-13(14)18)2-1-9-3-5-11(21)6-4-9/h3-8,21H |
| InChIKey | UMACXDHHIYVFEV-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.12 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|