C32H42N2O4Si3 — CID 139926252
bis[1-aminopropyl(diphenyl)silyl] dimethyl silicate (PubChem CID 139926252) has the molecular formula C32H42N2O4Si3 and a molecular weight of 602.96 g/mol. Its IUPAC name is bis[1-aminopropyl(diphenyl)silyl] dimethyl silicate.
| Compound Name | bis[1-aminopropyl(diphenyl)silyl] dimethyl silicate |
|---|---|
| PubChem CID | 139926252 |
| Molecular Formula | C32H42N2O4Si3 |
| Molecular Weight | 602.96 g/mol |
| Exact Mass | 602.25 |
| IUPAC Name | bis[1-aminopropyl(diphenyl)silyl] dimethyl silicate |
| SMILES | CCC(N)[Si](O[Si](OC)(OC)O[Si](c1ccccc1)(c1ccccc1)C(N)CC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H42N2O4Si3/c1-5-31(33)39(27-19-11-7-12-20-27,28-21-13-8-14-22-28)37-41(35-3,36-4)38-40(32(34)6-2,29-23-15-9-16-24-29)30-25-17-10-18-26-30/h7-26,31-32H,5-6,33-34H2,1-4H3 |
| InChIKey | RGOFWNHSJFCRKY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.96 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|