C27H47NO6 — CID 139927679
2-carboxyphenolate;[(Z)-octadec-9-enyl]-(2,2,2-trihydroxyethyl)azanium (PubChem CID 139927679) has the molecular formula C27H47NO6 and a molecular weight of 481.67 g/mol. Its IUPAC name is 2-carboxyphenolate;[(Z)-octadec-9-enyl]-(2,2,2-trihydroxyethyl)azanium.
| Compound Name | 2-carboxyphenolate;[(Z)-octadec-9-enyl]-(2,2,2-trihydroxyethyl)azanium |
|---|---|
| PubChem CID | 139927679 |
| Molecular Formula | C27H47NO6 |
| Molecular Weight | 481.67 g/mol |
| Exact Mass | 481.34 |
| IUPAC Name | 2-carboxyphenolate;[(Z)-octadec-9-enyl]-(2,2,2-trihydroxyethyl)azanium |
| SMILES | CCCCCCCC/C=C\CCCCCCCC[NH2+]CC(O)(O)O.O=C(O)c1ccccc1[O-] |
| InChI | InChI=1S/C20H41NO3.C7H6O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-19-20(22,23)24;8-6-4-2-1-3-5(6)7(9)10/h9-10,21-24H,2-8,11-19H2,1H3;1-4,8H,(H,9,10)/b10-9-; |
| InChIKey | GESDHIOPCXLNJL-KVVVOXFISA-N |
| XLogP | 3.68 |
| TPSA | 137.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.67 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|