C19H22F2N2 — CID 139928195
1,3-bis(4-ethylphenyl)-2,2-difluoroimidazolidine (PubChem CID 139928195) has the molecular formula C19H22F2N2 and a molecular weight of 316.40 g/mol. Its IUPAC name is 1,3-bis(4-ethylphenyl)-2,2-difluoroimidazolidine.
| Compound Name | 1,3-bis(4-ethylphenyl)-2,2-difluoroimidazolidine |
|---|---|
| PubChem CID | 139928195 |
| Molecular Formula | C19H22F2N2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 1,3-bis(4-ethylphenyl)-2,2-difluoroimidazolidine |
| SMILES | CCc1ccc(N2CCN(c3ccc(CC)cc3)C2(F)F)cc1 |
| InChI | InChI=1S/C19H22F2N2/c1-3-15-5-9-17(10-6-15)22-13-14-23(19(22,20)21)18-11-7-16(4-2)8-12-18/h5-12H,3-4,13-14H2,1-2H3 |
| InChIKey | JDTAKOPSGHSDGF-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|