C32H34N6O3S — CID 139930679
(2S)-N-[1-(1,3-benzothiazol-2-yl)-3-(3-methanehydrazonoylphenyl)-1-oxopropan-2-yl]-1-[(2S)-2-(deuteriomethylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide (PubChem CID 139930679) has the molecular formula C32H34N6O3S and a molecular weight of 583.74 g/mol. Its IUPAC name is (2S)-N-[1-(1,3-benzothiazol-2-yl)-3-(3-methanehydrazonoylphenyl)-1-oxopropan-2-yl]-1-[(2S)-2-(deuteriomethylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[1-(1,3-benzothiazol-2-yl)-3-(3-methanehydrazonoylphenyl)-1-oxopropan-2-yl]-1-[(2S)-2-(deuteriomethylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 139930679 |
| Molecular Formula | C32H34N6O3S |
| Molecular Weight | 583.74 g/mol |
| Exact Mass | 583.25 |
| IUPAC Name | (2S)-N-[1-(1,3-benzothiazol-2-yl)-3-(3-methanehydrazonoylphenyl)-1-oxopropan-2-yl]-1-[(2S)-2-(deuteriomethylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide |
| SMILES | [2H]CN[C@@H](Cc1ccccc1)C(=O)N1CCC[C@H]1C(=O)NC(Cc1cccc(C=NN)c1)C(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C32H34N6O3S/c1-34-26(18-21-9-3-2-4-10-21)32(41)38-16-8-14-27(38)30(40)36-25(19-22-11-7-12-23(17-22)20-35-33)29(39)31-37-24-13-5-6-15-28(24)42-31/h2-7,9-13,15,17,20,25-27,34H,8,14,16,18-19,33H2,1H3,(H,36,40)/t25?,26-,27-/m0/s1/i1D |
| InChIKey | FLDBTXQACMHRRD-PMROEFFKSA-N |
| XLogP | 3.32 |
| TPSA | 129.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.74 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|