C28H36F2N6O3 — CID 142638151
(2S)-1-[(2S)-2-(deuteriomethylamino)-3-phenylpropanoyl]-N-[3,3-difluoro-1-[3-(hydrazinylmethylideneamino)phenyl]-2-oxohexyl]pyrrolidine-2-carboxamide (PubChem CID 142638151) has the molecular formula C28H36F2N6O3 and a molecular weight of 543.64 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-(deuteriomethylamino)-3-phenylpropanoyl]-N-[3,3-difluoro-1-[3-(hydrazinylmethylideneamino)phenyl]-2-oxohexyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S)-2-(deuteriomethylamino)-3-phenylpropanoyl]-N-[3,3-difluoro-1-[3-(hydrazinylmethylideneamino)phenyl]-2-oxohexyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 142638151 |
| Molecular Formula | C28H36F2N6O3 |
| Molecular Weight | 543.64 g/mol |
| Exact Mass | 543.29 |
| IUPAC Name | (2S)-1-[(2S)-2-(deuteriomethylamino)-3-phenylpropanoyl]-N-[3,3-difluoro-1-[3-(hydrazinylmethylideneamino)phenyl]-2-oxohexyl]pyrrolidine-2-carboxamide |
| SMILES | [2H]CN[C@@H](Cc1ccccc1)C(=O)N1CCC[C@H]1C(=O)NC(C(=O)C(F)(F)CCC)c1cccc(/N=C/NN)c1 |
| InChI | InChI=1S/C28H36F2N6O3/c1-3-14-28(29,30)25(37)24(20-11-7-12-21(17-20)33-18-34-31)35-26(38)23-13-8-15-36(23)27(39)22(32-2)16-19-9-5-4-6-10-19/h4-7,9-12,17-18,22-24,32H,3,8,13-16,31H2,1-2H3,(H,33,34)(H,35,38)/t22-,23-,24?/m0/s1/i2D |
| InChIKey | KJECNCZBCLQBMF-HJEXMFGLSA-N |
| XLogP | 2.79 |
| TPSA | 128.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.64 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|