C10H13N3O3S2 — CID 139930843
N-(2-aminoethyl)-N-methyl-1-oxo-1,3-benzothiazole-7-sulfonamide (PubChem CID 139930843) has the molecular formula C10H13N3O3S2 and a molecular weight of 287.37 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-methyl-1-oxo-1,3-benzothiazole-7-sulfonamide.
| Compound Name | N-(2-aminoethyl)-N-methyl-1-oxo-1,3-benzothiazole-7-sulfonamide |
|---|---|
| PubChem CID | 139930843 |
| Molecular Formula | C10H13N3O3S2 |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | N-(2-aminoethyl)-N-methyl-1-oxo-1,3-benzothiazole-7-sulfonamide |
| SMILES | CN(CCN)S(=O)(=O)c1cccc2c1S(=O)C=N2 |
| InChI | InChI=1S/C10H13N3O3S2/c1-13(6-5-11)18(15,16)9-4-2-3-8-10(9)17(14)7-12-8/h2-4,7H,5-6,11H2,1H3 |
| InChIKey | VHICKXNBJQCASU-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |