About N-(3-bromopropyl)-N,2-dimethyl-3-(trifluoromethyl)benzenesulfonamide
N-(3-bromopropyl)-N,2-dimethyl-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 106441691) has the molecular formula C12H15BrF3NO2S
and a molecular weight of 374.22 g/mol. Its IUPAC name is N-(3-bromopropyl)-N,2-dimethyl-3-(trifluoromethyl)benzenesulfonamide.
Molecular Properties
| Compound Name | N-(3-bromopropyl)-N,2-dimethyl-3-(trifluoromethyl)benzenesulfonamide |
| PubChem CID | 106441691 |
| Molecular Formula | C12H15BrF3NO2S |
| Molecular Weight | 374.22 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | N-(3-bromopropyl)-N,2-dimethyl-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | Cc1c(C(F)(F)F)cccc1S(=O)(=O)N(C)CCCBr |
| InChI | InChI=1S/C12H15BrF3NO2S/c1-9-10(12(14,15)16)5-3-6-11(9)20(18,19)17(2)8-4-7-13/h3,5-6H,4,7-8H2,1-2H3 |
| InChIKey | COIUJVLUQYDWPB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.22 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(3-bromopropyl)-N,2-dimethyl-3-(trifluoromethyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-bromopropyl)-N,2-dimethyl-3-(trifluoromethyl)benzenesulfonamide?
The IUPAC name of N-(3-bromopropyl)-N,2-dimethyl-3-(trifluoromethyl)benzenesulfonamide (CID 106441691) is N-(3-bromopropyl)-N,2-dimethyl-3-(trifluoromethyl)benzenesulfonamide.
What is the SMILES notation for N-(3-bromopropyl)-N,2-dimethyl-3-(trifluoromethyl)benzenesulfonamide?
The canonical SMILES for N-(3-bromopropyl)-N,2-dimethyl-3-(trifluoromethyl)benzenesulfonamide is Cc1c(C(F)(F)F)cccc1S(=O)(=O)N(C)CCCBr.
What is the InChIKey of N-(3-bromopropyl)-N,2-dimethyl-3-(trifluoromethyl)benzenesulfonamide?
The InChIKey is COIUJVLUQYDWPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15BrF3NO2S/c1-9-10(12(14,15)16)5-3-6-11(9)20(18,19)17(2)8-4-7-13/h3,5-6H,4,7-8H2,1-2H3.
What are the key properties of N-(3-bromopropyl)-N,2-dimethyl-3-(trifluoromethyl)benzenesulfonamide?
N-(3-bromopropyl)-N,2-dimethyl-3-(trifluoromethyl)benzenesulfonamide has a molecular weight of 374.22 g/mol, XLogP of 3.42, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-bromopropyl)-N,2-dimethyl-3-(trifluoromethyl)benzenesulfonamide is sourced from PubChem (CID 106441691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).