C10H8O11 — CID 139935736
2-[(10E)-4-hydroxy-3,6,9,12-tetraoxo-1,2,7,8-tetraoxacyclododec-10-en-4-yl]acetic acid (PubChem CID 139935736) has the molecular formula C10H8O11 and a molecular weight of 304.16 g/mol. Its IUPAC name is 2-[(10E)-4-hydroxy-3,6,9,12-tetraoxo-1,2,7,8-tetraoxacyclododec-10-en-4-yl]acetic acid.
| Compound Name | 2-[(10E)-4-hydroxy-3,6,9,12-tetraoxo-1,2,7,8-tetraoxacyclododec-10-en-4-yl]acetic acid |
|---|---|
| PubChem CID | 139935736 |
| Molecular Formula | C10H8O11 |
| Molecular Weight | 304.16 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 2-[(10E)-4-hydroxy-3,6,9,12-tetraoxo-1,2,7,8-tetraoxacyclododec-10-en-4-yl]acetic acid |
| SMILES | O=C(O)CC1(O)CC(=O)OOC(=O)/C=C/C(=O)OOC1=O |
| InChI | InChI=1S/C10H8O11/c11-5(12)3-10(17)4-8(15)20-18-6(13)1-2-7(14)19-21-9(10)16/h1-2,17H,3-4H2,(H,11,12)/b2-1+ |
| InChIKey | UDAFWJIIKBAPJL-OWOJBTEDSA-N |
| XLogP | -1.85 |
| TPSA | 162.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.16 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|