C19H28O16 — CID 164608691
[(2S,3R,4R)-1,2,3,4,5-pentahydroxypentyl] 2-(4-hydroxy-3,6,9,16-tetraoxo-1,2,7,8-tetraoxacyclohexadec-4-yl)acetate (PubChem CID 164608691) has the molecular formula C19H28O16 and a molecular weight of 512.42 g/mol. Its IUPAC name is [(2S,3R,4R)-1,2,3,4,5-pentahydroxypentyl] 2-(4-hydroxy-3,6,9,16-tetraoxo-1,2,7,8-tetraoxacyclohexadec-4-yl)acetate.
| Compound Name | [(2S,3R,4R)-1,2,3,4,5-pentahydroxypentyl] 2-(4-hydroxy-3,6,9,16-tetraoxo-1,2,7,8-tetraoxacyclohexadec-4-yl)acetate |
|---|---|
| PubChem CID | 164608691 |
| Molecular Formula | C19H28O16 |
| Molecular Weight | 512.42 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | [(2S,3R,4R)-1,2,3,4,5-pentahydroxypentyl] 2-(4-hydroxy-3,6,9,16-tetraoxo-1,2,7,8-tetraoxacyclohexadec-4-yl)acetate |
| SMILES | O=C1CCCCCCC(=O)OOC(=O)C(O)(CC(=O)OC(O)[C@@H](O)[C@H](O)[C@H](O)CO)CC(=O)OO1 |
| InChI | InChI=1S/C19H28O16/c20-9-10(21)15(26)16(27)17(28)31-13(24)7-19(30)8-14(25)34-32-11(22)5-3-1-2-4-6-12(23)33-35-18(19)29/h10,15-17,20-21,26-28,30H,1-9H2/t10-,15-,16+,17?,19?/m1/s1 |
| InChIKey | ZVPXIBGFKGPYCK-VVVDWNNLSA-N |
| XLogP | -3.21 |
| TPSA | 252.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.42 |
| LogP ≤ 5 | -3.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|