C7H10O9 — CID 154724110
2-hydroxy-2-[(1S,3S)-1,2,3,4-tetrahydroxybutyl]-1,3-dioxolane-4,5-dione (PubChem CID 154724110) has the molecular formula C7H10O9 and a molecular weight of 238.15 g/mol. Its IUPAC name is 2-hydroxy-2-[(1S,3S)-1,2,3,4-tetrahydroxybutyl]-1,3-dioxolane-4,5-dione.
| Compound Name | 2-hydroxy-2-[(1S,3S)-1,2,3,4-tetrahydroxybutyl]-1,3-dioxolane-4,5-dione |
|---|---|
| PubChem CID | 154724110 |
| Molecular Formula | C7H10O9 |
| Molecular Weight | 238.15 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 2-hydroxy-2-[(1S,3S)-1,2,3,4-tetrahydroxybutyl]-1,3-dioxolane-4,5-dione |
| SMILES | O=C1OC(O)([C@@H](O)C(O)[C@@H](O)CO)OC1=O |
| InChI | InChI=1S/C7H10O9/c8-1-2(9)3(10)4(11)7(14)15-5(12)6(13)16-7/h2-4,8-11,14H,1H2/t2-,3?,4-/m0/s1 |
| InChIKey | TVIBZFBPJJCULR-QNVNXEQISA-N |
| XLogP | -4.19 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.15 |
| LogP ≤ 5 | -4.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|