C7H12O12S — CID 171781121
[(5R)-4,5-dihydroxy-2-oxo-5-[(1R,2R,3S)-1,2,3,4-tetrahydroxybutyl]-1,3-dioxolan-4-yl] hydrogen sulfite (PubChem CID 171781121) has the molecular formula C7H12O12S and a molecular weight of 320.23 g/mol. Its IUPAC name is [(5R)-4,5-dihydroxy-2-oxo-5-[(1R,2R,3S)-1,2,3,4-tetrahydroxybutyl]-1,3-dioxolan-4-yl] hydrogen sulfite.
| Compound Name | [(5R)-4,5-dihydroxy-2-oxo-5-[(1R,2R,3S)-1,2,3,4-tetrahydroxybutyl]-1,3-dioxolan-4-yl] hydrogen sulfite |
|---|---|
| PubChem CID | 171781121 |
| Molecular Formula | C7H12O12S |
| Molecular Weight | 320.23 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | [(5R)-4,5-dihydroxy-2-oxo-5-[(1R,2R,3S)-1,2,3,4-tetrahydroxybutyl]-1,3-dioxolan-4-yl] hydrogen sulfite |
| SMILES | O=C1OC(O)(OS(=O)O)[C@@](O)([C@H](O)[C@H](O)[C@@H](O)CO)O1 |
| InChI | InChI=1S/C7H12O12S/c8-1-2(9)3(10)4(11)6(13)7(14,19-20(15)16)18-5(12)17-6/h2-4,8-11,13-14H,1H2,(H,15,16)/t2-,3+,4+,6+,7?/m0/s1 |
| InChIKey | KTHPXHOYEOTEKF-KXBGFPOOSA-N |
| XLogP | -4.28 |
| TPSA | 203.44 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.23 |
| LogP ≤ 5 | -4.28 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|