C10H14O9 — CID 91220418
(3S)-3,6-dihydroxy-3-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]cyclohexane-1,2,4-trione (PubChem CID 91220418) has the molecular formula C10H14O9 and a molecular weight of 278.21 g/mol. Its IUPAC name is (3S)-3,6-dihydroxy-3-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]cyclohexane-1,2,4-trione.
| Compound Name | (3S)-3,6-dihydroxy-3-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]cyclohexane-1,2,4-trione |
|---|---|
| PubChem CID | 91220418 |
| Molecular Formula | C10H14O9 |
| Molecular Weight | 278.21 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | (3S)-3,6-dihydroxy-3-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]cyclohexane-1,2,4-trione |
| SMILES | O=C1C(=O)[C@](O)([C@@H](O)[C@H](O)[C@H](O)CO)C(=O)CC1O |
| InChI | InChI=1S/C10H14O9/c11-2-4(13)7(16)9(18)10(19)5(14)1-3(12)6(15)8(10)17/h3-4,7,9,11-13,16,18-19H,1-2H2/t3?,4-,7-,9+,10+/m1/s1 |
| InChIKey | LJMCFDRMHJPNMY-RNCWLVEMSA-N |
| XLogP | -4.74 |
| TPSA | 172.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.21 |
| LogP ≤ 5 | -4.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|