C13H26O11 — CID 158370527
(1R,3S,4R)-1,4-bis(hydroxymethyl)cyclopentane-1,2,3-triol;1,3,4,5,6-pentahydroxyhexan-2-one (PubChem CID 158370527) has the molecular formula C13H26O11 and a molecular weight of 358.34 g/mol. Its IUPAC name is (1R,3S,4R)-1,4-bis(hydroxymethyl)cyclopentane-1,2,3-triol;1,3,4,5,6-pentahydroxyhexan-2-one.
| Compound Name | (1R,3S,4R)-1,4-bis(hydroxymethyl)cyclopentane-1,2,3-triol;1,3,4,5,6-pentahydroxyhexan-2-one |
|---|---|
| PubChem CID | 158370527 |
| Molecular Formula | C13H26O11 |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | (1R,3S,4R)-1,4-bis(hydroxymethyl)cyclopentane-1,2,3-triol;1,3,4,5,6-pentahydroxyhexan-2-one |
| SMILES | O=C(CO)C(O)C(O)C(O)CO.OC[C@H]1C[C@@](O)(CO)C(O)[C@H]1O |
| InChI | InChI=1S/C7H14O5.C6H12O6/c8-2-4-1-7(12,3-9)6(11)5(4)10;7-1-3(9)5(11)6(12)4(10)2-8/h4-6,8-12H,1-3H2;3,5-9,11-12H,1-2H2/t4-,5+,6?,7-;/m1./s1 |
| InChIKey | GUOAQCWNGTZWIQ-HASCPWPMSA-N |
| XLogP | -5.93 |
| TPSA | 219.37 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | -5.93 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 11 |