C12H24O12 — CID 141491100
(2S,3S,4R,5R)-2-(hydroxymethyl)oxane-2,3,4,5-tetrol;(3S,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-one (PubChem CID 141491100) has the molecular formula C12H24O12 and a molecular weight of 360.31 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-(hydroxymethyl)oxane-2,3,4,5-tetrol;(3S,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-one.
| Compound Name | (2S,3S,4R,5R)-2-(hydroxymethyl)oxane-2,3,4,5-tetrol;(3S,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-one |
|---|---|
| PubChem CID | 141491100 |
| Molecular Formula | C12H24O12 |
| Molecular Weight | 360.31 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | (2S,3S,4R,5R)-2-(hydroxymethyl)oxane-2,3,4,5-tetrol;(3S,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-one |
| SMILES | O=C(CO)[C@@H](O)[C@@H](O)[C@H](O)CO.OC[C@]1(O)OC[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/2C6H12O6/c7-2-6(11)5(10)4(9)3(8)1-12-6;7-1-3(9)5(11)6(12)4(10)2-8/h3-5,7-11H,1-2H2;3,5-9,11-12H,1-2H2/t3-,4-,5+,6+;3-,5+,6-/m11/s1 |
| InChIKey | XEPQBYNVTQMEKI-GNKOKXEHSA-N |
| XLogP | -6.60 |
| TPSA | 228.60 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.31 |
| LogP ≤ 5 | -6.60 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |