C12H22O9 — CID 22319949
2-(oxiran-2-ylmethoxymethyl)oxirane;1,3,4,5,6-pentahydroxyhexan-2-one (PubChem CID 22319949) has the molecular formula C12H22O9 and a molecular weight of 310.30 g/mol. Its IUPAC name is 2-(oxiran-2-ylmethoxymethyl)oxirane;1,3,4,5,6-pentahydroxyhexan-2-one.
| Compound Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;1,3,4,5,6-pentahydroxyhexan-2-one |
|---|---|
| PubChem CID | 22319949 |
| Molecular Formula | C12H22O9 |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;1,3,4,5,6-pentahydroxyhexan-2-one |
| SMILES | C(OCC1CO1)C1CO1.O=C(CO)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C6H12O6.C6H10O3/c7-1-3(9)5(11)6(12)4(10)2-8;1(5-3-8-5)7-2-6-4-9-6/h3,5-9,11-12H,1-2H2;5-6H,1-4H2 |
| InChIKey | WLCPDTOYBCVWIO-UHFFFAOYSA-N |
| XLogP | -3.58 |
| TPSA | 152.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | -3.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|