C13H27NO11 — CID 131719636
(1S,2S,3R,4S,5S)-5-amino-1-(hydroxymethyl)cyclohexane-1,2,3,4-tetrol;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal (PubChem CID 131719636) has the molecular formula C13H27NO11 and a molecular weight of 373.36 g/mol. Its IUPAC name is (1S,2S,3R,4S,5S)-5-amino-1-(hydroxymethyl)cyclohexane-1,2,3,4-tetrol;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal.
| Compound Name | (1S,2S,3R,4S,5S)-5-amino-1-(hydroxymethyl)cyclohexane-1,2,3,4-tetrol;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| PubChem CID | 131719636 |
| Molecular Formula | C13H27NO11 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | (1S,2S,3R,4S,5S)-5-amino-1-(hydroxymethyl)cyclohexane-1,2,3,4-tetrol;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal |
| SMILES | N[C@H]1C[C@](O)(CO)[C@@H](O)[C@H](O)[C@H]1O.O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C7H15NO5.C6H12O6/c8-3-1-7(13,2-9)6(12)5(11)4(3)10;7-1-3(9)5(11)6(12)4(10)2-8/h3-6,9-13H,1-2,8H2;1,3-6,8-12H,2H2/t3-,4-,5+,6-,7-;3-,4+,5+,6+/m00/s1 |
| InChIKey | ODYTZBBNTFQTMH-VJSRFYAQSA-N |
| XLogP | -6.86 |
| TPSA | 245.39 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | -6.86 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|