C6H14O9S — CID 135349987
2,3,4,5,6-pentahydroxyhexanal;sulfurous acid (PubChem CID 135349987) has the molecular formula C6H14O9S and a molecular weight of 262.24 g/mol. Its IUPAC name is 2,3,4,5,6-pentahydroxyhexanal;sulfurous acid.
| Compound Name | 2,3,4,5,6-pentahydroxyhexanal;sulfurous acid |
|---|---|
| PubChem CID | 135349987 |
| Molecular Formula | C6H14O9S |
| Molecular Weight | 262.24 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 2,3,4,5,6-pentahydroxyhexanal;sulfurous acid |
| SMILES | O=CC(O)C(O)C(O)C(O)CO.O=S(O)O |
| InChI | InChI=1S/C6H12O6.H2O3S/c7-1-3(9)5(11)6(12)4(10)2-8;1-4(2)3/h1,3-6,8-12H,2H2;(H2,1,2,3) |
| InChIKey | WIZUBLSTGMUPPH-UHFFFAOYSA-N |
| XLogP | -3.70 |
| TPSA | 175.75 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.24 |
| LogP ≤ 5 | -3.70 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|