C19H21N5S — CID 139938417
3-(2-piperidin-4-ylethyl)-4-(1H-pyrrol-2-yl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaene (PubChem CID 139938417) has the molecular formula C19H21N5S and a molecular weight of 351.48 g/mol. Its IUPAC name is 3-(2-piperidin-4-ylethyl)-4-(1H-pyrrol-2-yl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaene.
| Compound Name | 3-(2-piperidin-4-ylethyl)-4-(1H-pyrrol-2-yl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaene |
|---|---|
| PubChem CID | 139938417 |
| Molecular Formula | C19H21N5S |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 3-(2-piperidin-4-ylethyl)-4-(1H-pyrrol-2-yl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaene |
| SMILES | c1c[nH]c(-c2nc3cnc4ccsc4c3n2CCC2CCNCC2)c1 |
| InChI | InChI=1S/C19H21N5S/c1-2-15(21-7-1)19-23-16-12-22-14-6-11-25-18(14)17(16)24(19)10-5-13-3-8-20-9-4-13/h1-2,6-7,11-13,20-21H,3-5,8-10H2 |
| InChIKey | WVFWARCDJVISHT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |