C4H5Br3O2S — CID 139938653
3,3,4-tribromothiolane 1,1-dioxide (PubChem CID 139938653) has the molecular formula C4H5Br3O2S and a molecular weight of 356.86 g/mol. Its IUPAC name is 3,3,4-tribromothiolane 1,1-dioxide.
| Compound Name | 3,3,4-tribromothiolane 1,1-dioxide |
|---|---|
| PubChem CID | 139938653 |
| Molecular Formula | C4H5Br3O2S |
| Molecular Weight | 356.86 g/mol |
| Exact Mass | 353.76 |
| IUPAC Name | 3,3,4-tribromothiolane 1,1-dioxide |
| SMILES | O=S1(=O)CC(Br)C(Br)(Br)C1 |
| InChI | InChI=1S/C4H5Br3O2S/c5-3-1-10(8,9)2-4(3,6)7/h3H,1-2H2 |
| InChIKey | NVTURZKWYAOVED-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.86 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|