C26H34N6O4 — CID 139942393
ethyl 2-(N-[2-[3-[N'-(1-ethanimidoylpiperidin-4-yl)carbamimidoyl]anilino]-2-oxoethyl]-2-hydroxyanilino)acetate (PubChem CID 139942393) has the molecular formula C26H34N6O4 and a molecular weight of 494.60 g/mol. Its IUPAC name is ethyl 2-(N-[2-[3-[N'-(1-ethanimidoylpiperidin-4-yl)carbamimidoyl]anilino]-2-oxoethyl]-2-hydroxyanilino)acetate.
| Compound Name | ethyl 2-(N-[2-[3-[N'-(1-ethanimidoylpiperidin-4-yl)carbamimidoyl]anilino]-2-oxoethyl]-2-hydroxyanilino)acetate |
|---|---|
| PubChem CID | 139942393 |
| Molecular Formula | C26H34N6O4 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | ethyl 2-(N-[2-[3-[N'-(1-ethanimidoylpiperidin-4-yl)carbamimidoyl]anilino]-2-oxoethyl]-2-hydroxyanilino)acetate |
| SMILES | [H]/N=C(\C)N1CCC(/N=C(\N)c2cccc(NC(=O)CN(CC(=O)OCC)c3ccccc3O)c2)CC1 |
| InChI | InChI=1S/C26H34N6O4/c1-3-36-25(35)17-32(22-9-4-5-10-23(22)33)16-24(34)29-21-8-6-7-19(15-21)26(28)30-20-11-13-31(14-12-20)18(2)27/h4-10,15,20,27,33H,3,11-14,16-17H2,1-2H3,(H2,28,30)(H,29,34)/b27-18+ |
| InChIKey | MKMLCMXNRNIQFL-OVVQPSECSA-N |
| XLogP | 2.57 |
| TPSA | 144.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|