C13H19N5 — CID 121400021
N-amino-N'-(1-ethanimidoylpyrrolidin-3-yl)benzenecarboximidamide (PubChem CID 121400021) has the molecular formula C13H19N5 and a molecular weight of 245.33 g/mol. Its IUPAC name is N-amino-N'-(1-ethanimidoylpyrrolidin-3-yl)benzenecarboximidamide.
| Compound Name | N-amino-N'-(1-ethanimidoylpyrrolidin-3-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 121400021 |
| Molecular Formula | C13H19N5 |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | N-amino-N'-(1-ethanimidoylpyrrolidin-3-yl)benzenecarboximidamide |
| SMILES | [H]/N=C(\C)N1CCC(/N=C(\NN)c2ccccc2)C1 |
| InChI | InChI=1S/C13H19N5/c1-10(14)18-8-7-12(9-18)16-13(17-15)11-5-3-2-4-6-11/h2-6,12,14H,7-9,15H2,1H3,(H,16,17)/b14-10+ |
| InChIKey | UOCKYAPXGLUYHN-GXDHUFHOSA-N |
| XLogP | 0.97 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|