C26H23N5O2 — CID 139944348
2-(4-aminophenyl)-N-[1-(2-pyrazol-1-ylacetyl)-2,3-dihydro-1H-isoindol-5-yl]benzamide (PubChem CID 139944348) has the molecular formula C26H23N5O2 and a molecular weight of 437.50 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-[1-(2-pyrazol-1-ylacetyl)-2,3-dihydro-1H-isoindol-5-yl]benzamide.
| Compound Name | 2-(4-aminophenyl)-N-[1-(2-pyrazol-1-ylacetyl)-2,3-dihydro-1H-isoindol-5-yl]benzamide |
|---|---|
| PubChem CID | 139944348 |
| Molecular Formula | C26H23N5O2 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 2-(4-aminophenyl)-N-[1-(2-pyrazol-1-ylacetyl)-2,3-dihydro-1H-isoindol-5-yl]benzamide |
| SMILES | Nc1ccc(-c2ccccc2C(=O)Nc2ccc3c(c2)CNC3C(=O)Cn2cccn2)cc1 |
| InChI | InChI=1S/C26H23N5O2/c27-19-8-6-17(7-9-19)21-4-1-2-5-23(21)26(33)30-20-10-11-22-18(14-20)15-28-25(22)24(32)16-31-13-3-12-29-31/h1-14,25,28H,15-16,27H2,(H,30,33) |
| InChIKey | JGVNNLCZYVGRFY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|