C30H54N2O3 — CID 139952475
3-N,5-N-diethyl-3-N,5-N-di(nonyl)-2,4,6-trioxabicyclo[5.3.1]undeca-1(11),7,9-triene-3,5-diamine (PubChem CID 139952475) has the molecular formula C30H54N2O3 and a molecular weight of 490.77 g/mol. Its IUPAC name is 3-N,5-N-diethyl-3-N,5-N-di(nonyl)-2,4,6-trioxabicyclo[5.3.1]undeca-1(11),7,9-triene-3,5-diamine.
| Compound Name | 3-N,5-N-diethyl-3-N,5-N-di(nonyl)-2,4,6-trioxabicyclo[5.3.1]undeca-1(11),7,9-triene-3,5-diamine |
|---|---|
| PubChem CID | 139952475 |
| Molecular Formula | C30H54N2O3 |
| Molecular Weight | 490.77 g/mol |
| Exact Mass | 490.41 |
| IUPAC Name | 3-N,5-N-diethyl-3-N,5-N-di(nonyl)-2,4,6-trioxabicyclo[5.3.1]undeca-1(11),7,9-triene-3,5-diamine |
| SMILES | CCCCCCCCCN(CC)C1Oc2cccc(c2)OC(N(CC)CCCCCCCCC)O1 |
| InChI | InChI=1S/C30H54N2O3/c1-5-9-11-13-15-17-19-24-31(7-3)29-33-27-22-21-23-28(26-27)34-30(35-29)32(8-4)25-20-18-16-14-12-10-6-2/h21-23,26,29-30H,5-20,24-25H2,1-4H3 |
| InChIKey | IDCRHBUIVQVEDT-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.77 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|