C24H42N2O3 — CID 139953422
3-N,7-N-dihexyl-3-N,7-N-dimethyl-2,5,8-trioxabicyclo[7.2.2]trideca-1(11),9,12-triene-3,7-diamine (PubChem CID 139953422) has the molecular formula C24H42N2O3 and a molecular weight of 406.61 g/mol. Its IUPAC name is 3-N,7-N-dihexyl-3-N,7-N-dimethyl-2,5,8-trioxabicyclo[7.2.2]trideca-1(11),9,12-triene-3,7-diamine.
| Compound Name | 3-N,7-N-dihexyl-3-N,7-N-dimethyl-2,5,8-trioxabicyclo[7.2.2]trideca-1(11),9,12-triene-3,7-diamine |
|---|---|
| PubChem CID | 139953422 |
| Molecular Formula | C24H42N2O3 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.32 |
| IUPAC Name | 3-N,7-N-dihexyl-3-N,7-N-dimethyl-2,5,8-trioxabicyclo[7.2.2]trideca-1(11),9,12-triene-3,7-diamine |
| SMILES | CCCCCCN(C)C1COCC(N(C)CCCCCC)Oc2ccc(cc2)O1 |
| InChI | InChI=1S/C24H42N2O3/c1-5-7-9-11-17-25(3)23-19-27-20-24(26(4)18-12-10-8-6-2)29-22-15-13-21(28-23)14-16-22/h13-16,23-24H,5-12,17-20H2,1-4H3 |
| InChIKey | BAUQAEOCBMOQQM-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|