C22H38N2O3 — CID 139956389
2-N,6-N-dimethyl-2-N,6-N-dipentyl-2,3,5,6-tetrahydro-1,4,7-benzotrioxonine-2,6-diamine (PubChem CID 139956389) has the molecular formula C22H38N2O3 and a molecular weight of 378.56 g/mol. Its IUPAC name is 2-N,6-N-dimethyl-2-N,6-N-dipentyl-2,3,5,6-tetrahydro-1,4,7-benzotrioxonine-2,6-diamine.
| Compound Name | 2-N,6-N-dimethyl-2-N,6-N-dipentyl-2,3,5,6-tetrahydro-1,4,7-benzotrioxonine-2,6-diamine |
|---|---|
| PubChem CID | 139956389 |
| Molecular Formula | C22H38N2O3 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.29 |
| IUPAC Name | 2-N,6-N-dimethyl-2-N,6-N-dipentyl-2,3,5,6-tetrahydro-1,4,7-benzotrioxonine-2,6-diamine |
| SMILES | CCCCCN(C)C1COCC(N(C)CCCCC)Oc2ccccc2O1 |
| InChI | InChI=1S/C22H38N2O3/c1-5-7-11-15-23(3)21-17-25-18-22(24(4)16-12-8-6-2)27-20-14-10-9-13-19(20)26-21/h9-10,13-14,21-22H,5-8,11-12,15-18H2,1-4H3 |
| InChIKey | NLPFCYYZOQRMSY-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|