C26H46N2O3 — CID 139953323
3-N,9-N-dihexyl-3-N,9-N-dimethyl-2,6,10-trioxabicyclo[9.4.0]pentadeca-1(15),11,13-triene-3,9-diamine (PubChem CID 139953323) has the molecular formula C26H46N2O3 and a molecular weight of 434.67 g/mol. Its IUPAC name is 3-N,9-N-dihexyl-3-N,9-N-dimethyl-2,6,10-trioxabicyclo[9.4.0]pentadeca-1(15),11,13-triene-3,9-diamine.
| Compound Name | 3-N,9-N-dihexyl-3-N,9-N-dimethyl-2,6,10-trioxabicyclo[9.4.0]pentadeca-1(15),11,13-triene-3,9-diamine |
|---|---|
| PubChem CID | 139953323 |
| Molecular Formula | C26H46N2O3 |
| Molecular Weight | 434.67 g/mol |
| Exact Mass | 434.35 |
| IUPAC Name | 3-N,9-N-dihexyl-3-N,9-N-dimethyl-2,6,10-trioxabicyclo[9.4.0]pentadeca-1(15),11,13-triene-3,9-diamine |
| SMILES | CCCCCCN(C)C1CCOCCC(N(C)CCCCCC)Oc2ccccc2O1 |
| InChI | InChI=1S/C26H46N2O3/c1-5-7-9-13-19-27(3)25-17-21-29-22-18-26(28(4)20-14-10-8-6-2)31-24-16-12-11-15-23(24)30-25/h11-12,15-16,25-26H,5-10,13-14,17-22H2,1-4H3 |
| InChIKey | IBXAWKOCUZWLIG-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.67 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|